C8H13NO5V — CID 160517386
(4R)-3-hydroxy-2-(1-hydroxyethyl)-4-methyl-5-oxopyrrolidine-2-carboxylic acid;vanadium (PubChem CID 160517386) has the molecular formula C8H13NO5V and a molecular weight of 254.14 g/mol. Its IUPAC name is (4R)-3-hydroxy-2-(1-hydroxyethyl)-4-methyl-5-oxopyrrolidine-2-carboxylic acid;vanadium.
| Compound Name | (4R)-3-hydroxy-2-(1-hydroxyethyl)-4-methyl-5-oxopyrrolidine-2-carboxylic acid;vanadium |
|---|---|
| PubChem CID | 160517386 |
| Molecular Formula | C8H13NO5V |
| Molecular Weight | 254.14 g/mol |
| Exact Mass | 254.02 |
| IUPAC Name | (4R)-3-hydroxy-2-(1-hydroxyethyl)-4-methyl-5-oxopyrrolidine-2-carboxylic acid;vanadium |
| SMILES | CC(O)C1(C(=O)O)NC(=O)[C@H](C)C1O.[V] |
| InChI | InChI=1S/C8H13NO5.V/c1-3-5(11)8(4(2)10,7(13)14)9-6(3)12;/h3-5,10-11H,1-2H3,(H,9,12)(H,13,14);/t3-,4?,5?,8?;/m1./s1 |
| InChIKey | QTVFTFQPOZXYGF-VPXSVNJFSA-N |
| XLogP | -1.69 |
| TPSA | 106.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.14 |
| LogP ≤ 5 | -1.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |