C10H13NO3 — CID 100960415
(1S,4R,5S)-4-methyl-1-(2-methylprop-1-enyl)-6-oxa-2-azabicyclo[3.2.0]heptane-3,7-dione (PubChem CID 100960415) has the molecular formula C10H13NO3 and a molecular weight of 195.22 g/mol. Its IUPAC name is (1S,4R,5S)-4-methyl-1-(2-methylprop-1-enyl)-6-oxa-2-azabicyclo[3.2.0]heptane-3,7-dione.
| Compound Name | (1S,4R,5S)-4-methyl-1-(2-methylprop-1-enyl)-6-oxa-2-azabicyclo[3.2.0]heptane-3,7-dione |
|---|---|
| PubChem CID | 100960415 |
| Molecular Formula | C10H13NO3 |
| Molecular Weight | 195.22 g/mol |
| Exact Mass | 195.09 |
| IUPAC Name | (1S,4R,5S)-4-methyl-1-(2-methylprop-1-enyl)-6-oxa-2-azabicyclo[3.2.0]heptane-3,7-dione |
| SMILES | CC(C)=C[C@]12NC(=O)[C@H](C)[C@@H]1OC2=O |
| InChI | InChI=1S/C10H13NO3/c1-5(2)4-10-7(14-9(10)13)6(3)8(12)11-10/h4,6-7H,1-3H3,(H,11,12)/t6-,7+,10+/m1/s1 |
| InChIKey | ILCOKUNTGMUSKF-FWWHASMVSA-N |
| XLogP | 0.38 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.22 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'four_member_lactones', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|