C16H20O4 — CID 134963807
(2E,4E)-2,4-dimethyl-5-[(4R)-4,6,7-trimethyl-3,5-dioxo-2-oxabicyclo[2.2.1]heptan-7-yl]penta-2,4-dienal (PubChem CID 134963807) has the molecular formula C16H20O4 and a molecular weight of 276.33 g/mol. Its IUPAC name is (2E,4E)-2,4-dimethyl-5-[(4R)-4,6,7-trimethyl-3,5-dioxo-2-oxabicyclo[2.2.1]heptan-7-yl]penta-2,4-dienal.
| Compound Name | (2E,4E)-2,4-dimethyl-5-[(4R)-4,6,7-trimethyl-3,5-dioxo-2-oxabicyclo[2.2.1]heptan-7-yl]penta-2,4-dienal |
|---|---|
| PubChem CID | 134963807 |
| Molecular Formula | C16H20O4 |
| Molecular Weight | 276.33 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | (2E,4E)-2,4-dimethyl-5-[(4R)-4,6,7-trimethyl-3,5-dioxo-2-oxabicyclo[2.2.1]heptan-7-yl]penta-2,4-dienal |
| SMILES | C/C(C=O)=C\C(C)=C\C1(C)C2OC(=O)[C@@]1(C)C(=O)C2C |
| InChI | InChI=1S/C16H20O4/c1-9(6-10(2)8-17)7-15(4)13-11(3)12(18)16(15,5)14(19)20-13/h6-8,11,13H,1-5H3/b9-7+,10-6+/t11?,13?,15?,16-/m1/s1 |
| InChIKey | IRIRJWSIWFHQMP-DJPLEOBASA-N |
| XLogP | 2.23 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.33 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|