C11H19NO3 — CID 165462680
4-(1-methoxyethyl)-8-oxa-1-azaspiro[4.5]decan-2-one (PubChem CID 165462680) has the molecular formula C11H19NO3 and a molecular weight of 213.28 g/mol. Its IUPAC name is 4-(1-methoxyethyl)-8-oxa-1-azaspiro[4.5]decan-2-one.
| Compound Name | 4-(1-methoxyethyl)-8-oxa-1-azaspiro[4.5]decan-2-one |
|---|---|
| PubChem CID | 165462680 |
| Molecular Formula | C11H19NO3 |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.14 |
| IUPAC Name | 4-(1-methoxyethyl)-8-oxa-1-azaspiro[4.5]decan-2-one |
| SMILES | COC(C)C1CC(=O)NC12CCOCC2 |
| InChI | InChI=1S/C11H19NO3/c1-8(14-2)9-7-10(13)12-11(9)3-5-15-6-4-11/h8-9H,3-7H2,1-2H3,(H,12,13) |
| InChIKey | XAQFTNNERCHQME-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |