C8H12N2O3 — CID 170903891
9-oxa-1,3-diazaspiro[5.5]undecane-2,4-dione (PubChem CID 170903891) has the molecular formula C8H12N2O3 and a molecular weight of 184.19 g/mol. Its IUPAC name is 9-oxa-1,3-diazaspiro[5.5]undecane-2,4-dione.
| Compound Name | 9-oxa-1,3-diazaspiro[5.5]undecane-2,4-dione |
|---|---|
| PubChem CID | 170903891 |
| Molecular Formula | C8H12N2O3 |
| Molecular Weight | 184.19 g/mol |
| Exact Mass | 184.08 |
| IUPAC Name | 9-oxa-1,3-diazaspiro[5.5]undecane-2,4-dione |
| SMILES | O=C1CC2(CCOCC2)NC(=O)N1 |
| InChI | InChI=1S/C8H12N2O3/c11-6-5-8(10-7(12)9-6)1-3-13-4-2-8/h1-5H2,(H2,9,10,11,12) |
| InChIKey | LGGXQPREXGPJNR-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.19 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |