C7H14Cl2N2O2 — CID 139019988
8-oxa-2,5-diazaspiro[3.6]decan-6-one;dihydrochloride (PubChem CID 139019988) has the molecular formula C7H14Cl2N2O2 and a molecular weight of 229.11 g/mol. Its IUPAC name is 8-oxa-2,5-diazaspiro[3.6]decan-6-one;dihydrochloride.
| Compound Name | 8-oxa-2,5-diazaspiro[3.6]decan-6-one;dihydrochloride |
|---|---|
| PubChem CID | 139019988 |
| Molecular Formula | C7H14Cl2N2O2 |
| Molecular Weight | 229.11 g/mol |
| Exact Mass | 228.04 |
| IUPAC Name | 8-oxa-2,5-diazaspiro[3.6]decan-6-one;dihydrochloride |
| SMILES | Cl.Cl.O=C1COCCC2(CNC2)N1 |
| InChI | InChI=1S/C7H12N2O2.2ClH/c10-6-3-11-2-1-7(9-6)4-8-5-7;;/h8H,1-5H2,(H,9,10);2*1H |
| InChIKey | NHALAFSEDFZIEC-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.11 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |