About 8-oxa-2,5-diazaspiro[3.6]decan-6-one;dihydrochloride
8-oxa-2,5-diazaspiro[3.6]decan-6-one;dihydrochloride (PubChem CID 139019988) has the molecular formula C7H14Cl2N2O2
and a molecular weight of 229.11 g/mol. Its IUPAC name is 8-oxa-2,5-diazaspiro[3.6]decan-6-one;dihydrochloride.
Molecular Properties
| Compound Name | 8-oxa-2,5-diazaspiro[3.6]decan-6-one;dihydrochloride |
| PubChem CID | 139019988 |
| Molecular Formula | C7H14Cl2N2O2 |
| Molecular Weight | 229.11 g/mol |
| Exact Mass | 228.04 |
| IUPAC Name | 8-oxa-2,5-diazaspiro[3.6]decan-6-one;dihydrochloride |
| SMILES | Cl.Cl.O=C1COCCC2(CNC2)N1 |
| InChI | InChI=1S/C7H12N2O2.2ClH/c10-6-3-11-2-1-7(9-6)4-8-5-7;;/h8H,1-5H2,(H,9,10);2*1H |
| InChIKey | NHALAFSEDFZIEC-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.11 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 8-oxa-2,5-diazaspiro[3.6]decan-6-one;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-oxa-2,5-diazaspiro[3.6]decan-6-one;dihydrochloride?
The IUPAC name of 8-oxa-2,5-diazaspiro[3.6]decan-6-one;dihydrochloride (CID 139019988) is 8-oxa-2,5-diazaspiro[3.6]decan-6-one;dihydrochloride.
What is the SMILES notation for 8-oxa-2,5-diazaspiro[3.6]decan-6-one;dihydrochloride?
The canonical SMILES for 8-oxa-2,5-diazaspiro[3.6]decan-6-one;dihydrochloride is Cl.Cl.O=C1COCCC2(CNC2)N1.
What is the InChIKey of 8-oxa-2,5-diazaspiro[3.6]decan-6-one;dihydrochloride?
The InChIKey is NHALAFSEDFZIEC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N2O2.2ClH/c10-6-3-11-2-1-7(9-6)4-8-5-7;;/h8H,1-5H2,(H,9,10);2*1H.
What are the key properties of 8-oxa-2,5-diazaspiro[3.6]decan-6-one;dihydrochloride?
8-oxa-2,5-diazaspiro[3.6]decan-6-one;dihydrochloride has a molecular weight of 229.11 g/mol, XLogP of -0.29, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-oxa-2,5-diazaspiro[3.6]decan-6-one;dihydrochloride is sourced from PubChem (CID 139019988), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).