C7H13N3O — CID 83679914
1,3,9-triazaspiro[4.5]decan-2-one (PubChem CID 83679914) has the molecular formula C7H13N3O and a molecular weight of 155.20 g/mol. Its IUPAC name is 1,3,9-triazaspiro[4.5]decan-2-one.
| Compound Name | 1,3,9-triazaspiro[4.5]decan-2-one |
|---|---|
| PubChem CID | 83679914 |
| Molecular Formula | C7H13N3O |
| Molecular Weight | 155.20 g/mol |
| Exact Mass | 155.11 |
| IUPAC Name | 1,3,9-triazaspiro[4.5]decan-2-one |
| SMILES | O=C1NCC2(CCCNC2)N1 |
| InChI | InChI=1S/C7H13N3O/c11-6-9-5-7(10-6)2-1-3-8-4-7/h8H,1-5H2,(H2,9,10,11) |
| InChIKey | OWDXVKSJDZVIRF-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.20 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |