C8H14N2O2 — CID 115067081
4-oxa-1,8-diazaspiro[5.5]undecan-2-one (PubChem CID 115067081) has the molecular formula C8H14N2O2 and a molecular weight of 170.21 g/mol. Its IUPAC name is 4-oxa-1,8-diazaspiro[5.5]undecan-2-one.
| Compound Name | 4-oxa-1,8-diazaspiro[5.5]undecan-2-one |
|---|---|
| PubChem CID | 115067081 |
| Molecular Formula | C8H14N2O2 |
| Molecular Weight | 170.21 g/mol |
| Exact Mass | 170.11 |
| IUPAC Name | 4-oxa-1,8-diazaspiro[5.5]undecan-2-one |
| SMILES | O=C1COCC2(CCCNC2)N1 |
| InChI | InChI=1S/C8H14N2O2/c11-7-4-12-6-8(10-7)2-1-3-9-5-8/h9H,1-6H2,(H,10,11) |
| InChIKey | HTMMPVZEICOSLR-UHFFFAOYSA-N |
| XLogP | -0.75 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.21 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |