C7H12N2O2 — CID 83872853
3-oxa-1,9-diazaspiro[4.5]decan-2-one (PubChem CID 83872853) has the molecular formula C7H12N2O2 and a molecular weight of 156.18 g/mol. Its IUPAC name is 3-oxa-1,9-diazaspiro[4.5]decan-2-one.
| Compound Name | 3-oxa-1,9-diazaspiro[4.5]decan-2-one |
|---|---|
| PubChem CID | 83872853 |
| Molecular Formula | C7H12N2O2 |
| Molecular Weight | 156.18 g/mol |
| Exact Mass | 156.09 |
| IUPAC Name | 3-oxa-1,9-diazaspiro[4.5]decan-2-one |
| SMILES | O=C1NC2(CCCNC2)CO1 |
| InChI | InChI=1S/C7H12N2O2/c10-6-9-7(5-11-6)2-1-3-8-4-7/h8H,1-5H2,(H,9,10) |
| InChIKey | OLQCFJLSEHXWBZ-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.18 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |