C9H19Cl2N3O — CID 162422718
2,7,10-triazaspiro[5.6]dodecan-8-one;dihydrochloride (PubChem CID 162422718) has the molecular formula C9H19Cl2N3O and a molecular weight of 256.18 g/mol. Its IUPAC name is 2,7,10-triazaspiro[5.6]dodecan-8-one;dihydrochloride.
| Compound Name | 2,7,10-triazaspiro[5.6]dodecan-8-one;dihydrochloride |
|---|---|
| PubChem CID | 162422718 |
| Molecular Formula | C9H19Cl2N3O |
| Molecular Weight | 256.18 g/mol |
| Exact Mass | 255.09 |
| IUPAC Name | 2,7,10-triazaspiro[5.6]dodecan-8-one;dihydrochloride |
| SMILES | Cl.Cl.O=C1CNCCC2(CCCNC2)N1 |
| InChI | InChI=1S/C9H17N3O.2ClH/c13-8-6-10-5-3-9(12-8)2-1-4-11-7-9;;/h10-11H,1-7H2,(H,12,13);2*1H |
| InChIKey | CSKIUPOPRXLZJC-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.18 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |