2-oxo-1,4,9-triazaspiro[5.5]undecane-9-carboxylic acid

C9H15N3O3 — CID 151434915

IUPAC2-oxo-1,4,9-triazaspiro[5.5]undecane-9-carboxylic acid
SMILESO=C1CNCC2(CCN(C(=O)O)CC2)N1
InChIInChI=1S/C9H15N3O3/c13-7-5-10-6-9(11-7)1-3-12(4-2-9)8(14)15/h10H,1-6H2,(H,11,13)(H,14,15)
InChIKeyPDHGFAAORSROLA-UHFFFAOYSA-N
MW213.24 g/mol
LogP-0.78
Rot. Bonds

About 2-oxo-1,4,9-triazaspiro[5.5]undecane-9-carboxylic acid

2-oxo-1,4,9-triazaspiro[5.5]undecane-9-carboxylic acid (PubChem CID 151434915) has the molecular formula C9H15N3O3 and a molecular weight of 213.24 g/mol. Its IUPAC name is 2-oxo-1,4,9-triazaspiro[5.5]undecane-9-carboxylic acid.

Molecular Properties

Compound Name2-oxo-1,4,9-triazaspiro[5.5]undecane-9-carboxylic acid
PubChem CID151434915
Molecular FormulaC9H15N3O3
Molecular Weight213.24 g/mol
Exact Mass213.11
IUPAC Name2-oxo-1,4,9-triazaspiro[5.5]undecane-9-carboxylic acid
SMILESO=C1CNCC2(CCN(C(=O)O)CC2)N1
InChIInChI=1S/C9H15N3O3/c13-7-5-10-6-9(11-7)1-3-12(4-2-9)8(14)15/h10H,1-6H2,(H,11,13)(H,14,15)
InChIKeyPDHGFAAORSROLA-UHFFFAOYSA-N
XLogP-0.78
TPSA81.67 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500213.24
LogP ≤ 5-0.78
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Analyze 2-oxo-1,4,9-triazaspiro[5.5]undecane-9-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-oxo-1,4,9-triazaspiro[5.5]undecane-9-carboxylic acid?
The IUPAC name of 2-oxo-1,4,9-triazaspiro[5.5]undecane-9-carboxylic acid (CID 151434915) is 2-oxo-1,4,9-triazaspiro[5.5]undecane-9-carboxylic acid.
What is the SMILES notation for 2-oxo-1,4,9-triazaspiro[5.5]undecane-9-carboxylic acid?
The canonical SMILES for 2-oxo-1,4,9-triazaspiro[5.5]undecane-9-carboxylic acid is O=C1CNCC2(CCN(C(=O)O)CC2)N1.
What is the InChIKey of 2-oxo-1,4,9-triazaspiro[5.5]undecane-9-carboxylic acid?
The InChIKey is PDHGFAAORSROLA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N3O3/c13-7-5-10-6-9(11-7)1-3-12(4-2-9)8(14)15/h10H,1-6H2,(H,11,13)(H,14,15).
What are the key properties of 2-oxo-1,4,9-triazaspiro[5.5]undecane-9-carboxylic acid?
2-oxo-1,4,9-triazaspiro[5.5]undecane-9-carboxylic acid has a molecular weight of 213.24 g/mol, XLogP of -0.78, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-oxo-1,4,9-triazaspiro[5.5]undecane-9-carboxylic acid is sourced from PubChem (CID 151434915), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).