9-oxo-7-oxa-3,10-diazaspiro[5.6]dodecane-3-carboxylic acid

C10H16N2O4 — CID 67293081

IUPAC9-oxo-7-oxa-3,10-diazaspiro[5.6]dodecane-3-carboxylic acid
SMILESO=C1COC2(CCN1)CCN(C(=O)O)CC2
InChIInChI=1S/C10H16N2O4/c13-8-7-16-10(1-4-11-8)2-5-12(6-3-10)9(14)15/h1-7H2,(H,11,13)(H,14,15)
InChIKeyZHQQWJCBIONKKE-UHFFFAOYSA-N
MW228.25 g/mol
LogP0.04
Rot. Bonds

About 9-oxo-7-oxa-3,10-diazaspiro[5.6]dodecane-3-carboxylic acid

9-oxo-7-oxa-3,10-diazaspiro[5.6]dodecane-3-carboxylic acid (PubChem CID 67293081) has the molecular formula C10H16N2O4 and a molecular weight of 228.25 g/mol. Its IUPAC name is 9-oxo-7-oxa-3,10-diazaspiro[5.6]dodecane-3-carboxylic acid.

Molecular Properties

Compound Name9-oxo-7-oxa-3,10-diazaspiro[5.6]dodecane-3-carboxylic acid
PubChem CID67293081
Molecular FormulaC10H16N2O4
Molecular Weight228.25 g/mol
Exact Mass228.11
IUPAC Name9-oxo-7-oxa-3,10-diazaspiro[5.6]dodecane-3-carboxylic acid
SMILESO=C1COC2(CCN1)CCN(C(=O)O)CC2
InChIInChI=1S/C10H16N2O4/c13-8-7-16-10(1-4-11-8)2-5-12(6-3-10)9(14)15/h1-7H2,(H,11,13)(H,14,15)
InChIKeyZHQQWJCBIONKKE-UHFFFAOYSA-N
XLogP0.04
TPSA78.87 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500228.25
LogP ≤ 50.04
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 9-oxo-7-oxa-3,10-diazaspiro[5.6]dodecane-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 9-oxo-7-oxa-3,10-diazaspiro[5.6]dodecane-3-carboxylic acid?
The IUPAC name of 9-oxo-7-oxa-3,10-diazaspiro[5.6]dodecane-3-carboxylic acid (CID 67293081) is 9-oxo-7-oxa-3,10-diazaspiro[5.6]dodecane-3-carboxylic acid.
What is the SMILES notation for 9-oxo-7-oxa-3,10-diazaspiro[5.6]dodecane-3-carboxylic acid?
The canonical SMILES for 9-oxo-7-oxa-3,10-diazaspiro[5.6]dodecane-3-carboxylic acid is O=C1COC2(CCN1)CCN(C(=O)O)CC2.
What is the InChIKey of 9-oxo-7-oxa-3,10-diazaspiro[5.6]dodecane-3-carboxylic acid?
The InChIKey is ZHQQWJCBIONKKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N2O4/c13-8-7-16-10(1-4-11-8)2-5-12(6-3-10)9(14)15/h1-7H2,(H,11,13)(H,14,15).
What are the key properties of 9-oxo-7-oxa-3,10-diazaspiro[5.6]dodecane-3-carboxylic acid?
9-oxo-7-oxa-3,10-diazaspiro[5.6]dodecane-3-carboxylic acid has a molecular weight of 228.25 g/mol, XLogP of 0.04, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 9-oxo-7-oxa-3,10-diazaspiro[5.6]dodecane-3-carboxylic acid is sourced from PubChem (CID 67293081), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).