C10H14N2O5 — CID 90908477
3-oxo-2,8-diazaspiro[4.5]decane-4,8-dicarboxylic acid (PubChem CID 90908477) has the molecular formula C10H14N2O5 and a molecular weight of 242.23 g/mol. Its IUPAC name is 3-oxo-2,8-diazaspiro[4.5]decane-4,8-dicarboxylic acid.
| Compound Name | 3-oxo-2,8-diazaspiro[4.5]decane-4,8-dicarboxylic acid |
|---|---|
| PubChem CID | 90908477 |
| Molecular Formula | C10H14N2O5 |
| Molecular Weight | 242.23 g/mol |
| Exact Mass | 242.09 |
| IUPAC Name | 3-oxo-2,8-diazaspiro[4.5]decane-4,8-dicarboxylic acid |
| SMILES | O=C(O)C1C(=O)NCC12CCN(C(=O)O)CC2 |
| InChI | InChI=1S/C10H14N2O5/c13-7-6(8(14)15)10(5-11-7)1-3-12(4-2-10)9(16)17/h6H,1-5H2,(H,11,13)(H,14,15)(H,16,17) |
| InChIKey | RBMYMKKHIQUZRS-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.23 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|