3-oxo-2,8-diazaspiro[4.5]decane-4,8-dicarboxylic acid

C10H14N2O5 — CID 90908477

IUPAC3-oxo-2,8-diazaspiro[4.5]decane-4,8-dicarboxylic acid
SMILESO=C(O)C1C(=O)NCC12CCN(C(=O)O)CC2
InChIInChI=1S/C10H14N2O5/c13-7-6(8(14)15)10(5-11-7)1-3-12(4-2-10)9(16)17/h6H,1-5H2,(H,11,13)(H,14,15)(H,16,17)
InChIKeyRBMYMKKHIQUZRS-UHFFFAOYSA-N
MW242.23 g/mol
LogP-0.42
Rot. Bonds1

About 3-oxo-2,8-diazaspiro[4.5]decane-4,8-dicarboxylic acid

3-oxo-2,8-diazaspiro[4.5]decane-4,8-dicarboxylic acid (PubChem CID 90908477) has the molecular formula C10H14N2O5 and a molecular weight of 242.23 g/mol. Its IUPAC name is 3-oxo-2,8-diazaspiro[4.5]decane-4,8-dicarboxylic acid.

Molecular Properties

Compound Name3-oxo-2,8-diazaspiro[4.5]decane-4,8-dicarboxylic acid
PubChem CID90908477
Molecular FormulaC10H14N2O5
Molecular Weight242.23 g/mol
Exact Mass242.09
IUPAC Name3-oxo-2,8-diazaspiro[4.5]decane-4,8-dicarboxylic acid
SMILESO=C(O)C1C(=O)NCC12CCN(C(=O)O)CC2
InChIInChI=1S/C10H14N2O5/c13-7-6(8(14)15)10(5-11-7)1-3-12(4-2-10)9(16)17/h6H,1-5H2,(H,11,13)(H,14,15)(H,16,17)
InChIKeyRBMYMKKHIQUZRS-UHFFFAOYSA-N
XLogP-0.42
TPSA106.94 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500242.23
LogP ≤ 5-0.42
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}

Analyze 3-oxo-2,8-diazaspiro[4.5]decane-4,8-dicarboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-oxo-2,8-diazaspiro[4.5]decane-4,8-dicarboxylic acid?
The IUPAC name of 3-oxo-2,8-diazaspiro[4.5]decane-4,8-dicarboxylic acid (CID 90908477) is 3-oxo-2,8-diazaspiro[4.5]decane-4,8-dicarboxylic acid.
What is the SMILES notation for 3-oxo-2,8-diazaspiro[4.5]decane-4,8-dicarboxylic acid?
The canonical SMILES for 3-oxo-2,8-diazaspiro[4.5]decane-4,8-dicarboxylic acid is O=C(O)C1C(=O)NCC12CCN(C(=O)O)CC2.
What is the InChIKey of 3-oxo-2,8-diazaspiro[4.5]decane-4,8-dicarboxylic acid?
The InChIKey is RBMYMKKHIQUZRS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2O5/c13-7-6(8(14)15)10(5-11-7)1-3-12(4-2-10)9(16)17/h6H,1-5H2,(H,11,13)(H,14,15)(H,16,17).
What are the key properties of 3-oxo-2,8-diazaspiro[4.5]decane-4,8-dicarboxylic acid?
3-oxo-2,8-diazaspiro[4.5]decane-4,8-dicarboxylic acid has a molecular weight of 242.23 g/mol, XLogP of -0.42, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-oxo-2,8-diazaspiro[4.5]decane-4,8-dicarboxylic acid is sourced from PubChem (CID 90908477), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).