C10H12N2O5 — CID 150219126
1-oxo-2,8-diazaspiro[4.5]dec-2-ene-3,8-dicarboxylic acid (PubChem CID 150219126) has the molecular formula C10H12N2O5 and a molecular weight of 240.21 g/mol. Its IUPAC name is 1-oxo-2,8-diazaspiro[4.5]dec-2-ene-3,8-dicarboxylic acid.
| Compound Name | 1-oxo-2,8-diazaspiro[4.5]dec-2-ene-3,8-dicarboxylic acid |
|---|---|
| PubChem CID | 150219126 |
| Molecular Formula | C10H12N2O5 |
| Molecular Weight | 240.21 g/mol |
| Exact Mass | 240.07 |
| IUPAC Name | 1-oxo-2,8-diazaspiro[4.5]dec-2-ene-3,8-dicarboxylic acid |
| SMILES | O=C(O)C1=NC(=O)C2(CCN(C(=O)O)CC2)C1 |
| InChI | InChI=1S/C10H12N2O5/c13-7(14)6-5-10(8(15)11-6)1-3-12(4-2-10)9(16)17/h1-5H2,(H,13,14)(H,16,17) |
| InChIKey | FTCHLTBIECDRSO-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 107.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.21 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |