About spiro[1,2-dihydroindene-3,4'-piperidine]-1'-carboxylic acid
spiro[1,2-dihydroindene-3,4'-piperidine]-1'-carboxylic acid (PubChem CID 66954084) has the molecular formula C14H17NO2
and a molecular weight of 231.29 g/mol. Its IUPAC name is spiro[1,2-dihydroindene-3,4'-piperidine]-1'-carboxylic acid.
Analyze spiro[1,2-dihydroindene-3,4'-piperidine]-1'-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of spiro[1,2-dihydroindene-3,4'-piperidine]-1'-carboxylic acid?
The IUPAC name of spiro[1,2-dihydroindene-3,4'-piperidine]-1'-carboxylic acid (CID 66954084) is spiro[1,2-dihydroindene-3,4'-piperidine]-1'-carboxylic acid.
What is the SMILES notation for spiro[1,2-dihydroindene-3,4'-piperidine]-1'-carboxylic acid?
The canonical SMILES for spiro[1,2-dihydroindene-3,4'-piperidine]-1'-carboxylic acid is O=C(O)N1CCC2(CCc3ccccc32)CC1.
What is the InChIKey of spiro[1,2-dihydroindene-3,4'-piperidine]-1'-carboxylic acid?
The InChIKey is ZLBXMYOTLVNGOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17NO2/c16-13(17)15-9-7-14(8-10-15)6-5-11-3-1-2-4-12(11)14/h1-4H,5-10H2,(H,16,17).
What are the key properties of spiro[1,2-dihydroindene-3,4'-piperidine]-1'-carboxylic acid?
spiro[1,2-dihydroindene-3,4'-piperidine]-1'-carboxylic acid has a molecular weight of 231.29 g/mol, XLogP of 2.64, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for spiro[1,2-dihydroindene-3,4'-piperidine]-1'-carboxylic acid is sourced from PubChem (CID 66954084), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).