C10H20N4O2 — CID 10944213
1,4,8,11-tetrazacyclotetradecane-2,10-dione (PubChem CID 10944213) has the molecular formula C10H20N4O2 and a molecular weight of 228.30 g/mol. Its IUPAC name is 1,4,8,11-tetrazacyclotetradecane-2,10-dione.
| Compound Name | 1,4,8,11-tetrazacyclotetradecane-2,10-dione |
|---|---|
| PubChem CID | 10944213 |
| Molecular Formula | C10H20N4O2 |
| Molecular Weight | 228.30 g/mol |
| Exact Mass | 228.16 |
| IUPAC Name | 1,4,8,11-tetrazacyclotetradecane-2,10-dione |
| SMILES | O=C1CNCCCNCC(=O)NCCCN1 |
| InChI | InChI=1S/C10H20N4O2/c15-9-7-11-3-1-4-12-8-10(16)14-6-2-5-13-9/h11-12H,1-8H2,(H,13,15)(H,14,16) |
| InChIKey | DLVUYESUZNSZGG-UHFFFAOYSA-N |
| XLogP | -1.81 |
| TPSA | 82.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.30 |
| LogP ≤ 5 | -1.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |