About 2-sulfonyl-1,4-diazepane
2-sulfonyl-1,4-diazepane (PubChem CID 140548243) has the molecular formula C5H10N2O2S
and a molecular weight of 162.21 g/mol. Its IUPAC name is 2-sulfonyl-1,4-diazepane.
Molecular Properties
| Compound Name | 2-sulfonyl-1,4-diazepane |
| PubChem CID | 140548243 |
| Molecular Formula | C5H10N2O2S |
| Molecular Weight | 162.21 g/mol |
| Exact Mass | 162.05 |
| IUPAC Name | 2-sulfonyl-1,4-diazepane |
| SMILES | O=S(=O)=C1CNCCCN1 |
| InChI | InChI=1S/C5H10N2O2S/c8-10(9)5-4-6-2-1-3-7-5/h6-7H,1-4H2 |
| InChIKey | RREKYUZHCRFWGN-UHFFFAOYSA-N |
| XLogP | -1.42 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.21 |
| LogP ≤ 5 | -1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-sulfonyl-1,4-diazepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-sulfonyl-1,4-diazepane?
The IUPAC name of 2-sulfonyl-1,4-diazepane (CID 140548243) is 2-sulfonyl-1,4-diazepane.
What is the SMILES notation for 2-sulfonyl-1,4-diazepane?
The canonical SMILES for 2-sulfonyl-1,4-diazepane is O=S(=O)=C1CNCCCN1.
What is the InChIKey of 2-sulfonyl-1,4-diazepane?
The InChIKey is RREKYUZHCRFWGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10N2O2S/c8-10(9)5-4-6-2-1-3-7-5/h6-7H,1-4H2.
What are the key properties of 2-sulfonyl-1,4-diazepane?
2-sulfonyl-1,4-diazepane has a molecular weight of 162.21 g/mol, XLogP of -1.42, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-sulfonyl-1,4-diazepane is sourced from PubChem (CID 140548243), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).