About piperazin-2-one;sulfuryl dichloride
piperazin-2-one;sulfuryl dichloride (PubChem CID 126685748) has the molecular formula C4H8Cl2N2O3S
and a molecular weight of 235.09 g/mol. Its IUPAC name is piperazin-2-one;sulfuryl dichloride.
Molecular Properties
| Compound Name | piperazin-2-one;sulfuryl dichloride |
| PubChem CID | 126685748 |
| Molecular Formula | C4H8Cl2N2O3S |
| Molecular Weight | 235.09 g/mol |
| Exact Mass | 233.96 |
| IUPAC Name | piperazin-2-one;sulfuryl dichloride |
| SMILES | O=C1CNCCN1.O=S(=O)(Cl)Cl |
| InChI | InChI=1S/C4H8N2O.Cl2O2S/c7-4-3-5-1-2-6-4;1-5(2,3)4/h5H,1-3H2,(H,6,7); |
| InChIKey | FLQQEQQHXAOKMN-UHFFFAOYSA-N |
| XLogP | -0.59 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.09 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze piperazin-2-one;sulfuryl dichloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of piperazin-2-one;sulfuryl dichloride?
The IUPAC name of piperazin-2-one;sulfuryl dichloride (CID 126685748) is piperazin-2-one;sulfuryl dichloride.
What is the SMILES notation for piperazin-2-one;sulfuryl dichloride?
The canonical SMILES for piperazin-2-one;sulfuryl dichloride is O=C1CNCCN1.O=S(=O)(Cl)Cl.
What is the InChIKey of piperazin-2-one;sulfuryl dichloride?
The InChIKey is FLQQEQQHXAOKMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8N2O.Cl2O2S/c7-4-3-5-1-2-6-4;1-5(2,3)4/h5H,1-3H2,(H,6,7);.
What are the key properties of piperazin-2-one;sulfuryl dichloride?
piperazin-2-one;sulfuryl dichloride has a molecular weight of 235.09 g/mol, XLogP of -0.59, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for piperazin-2-one;sulfuryl dichloride is sourced from PubChem (CID 126685748), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).