C7H18N2O — CID 143599230
7,7-dimethyl-1,4-diazepan-2-one;molecular hydrogen (PubChem CID 143599230) has the molecular formula C7H18N2O and a molecular weight of 146.23 g/mol. Its IUPAC name is 7,7-dimethyl-1,4-diazepan-2-one;molecular hydrogen.
| Compound Name | 7,7-dimethyl-1,4-diazepan-2-one;molecular hydrogen |
|---|---|
| PubChem CID | 143599230 |
| Molecular Formula | C7H18N2O |
| Molecular Weight | 146.23 g/mol |
| Exact Mass | 146.14 |
| IUPAC Name | 7,7-dimethyl-1,4-diazepan-2-one;molecular hydrogen |
| SMILES | CC1(C)CCNCC(=O)N1.[H][H].[H][H] |
| InChI | InChI=1S/C7H14N2O.2H2/c1-7(2)3-4-8-5-6(10)9-7;;/h8H,3-5H2,1-2H3,(H,9,10);2*1H |
| InChIKey | VLTLQPIHVAKMRX-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.23 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |