C9H15N3O2 — CID 134828274
(5S)-6,6-dimethyl-1,3,8-triazaspiro[4.5]decane-2,4-dione (PubChem CID 134828274) has the molecular formula C9H15N3O2 and a molecular weight of 197.24 g/mol. Its IUPAC name is (5S)-6,6-dimethyl-1,3,8-triazaspiro[4.5]decane-2,4-dione.
| Compound Name | (5S)-6,6-dimethyl-1,3,8-triazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 134828274 |
| Molecular Formula | C9H15N3O2 |
| Molecular Weight | 197.24 g/mol |
| Exact Mass | 197.12 |
| IUPAC Name | (5S)-6,6-dimethyl-1,3,8-triazaspiro[4.5]decane-2,4-dione |
| SMILES | CC1(C)CNCC[C@]12NC(=O)NC2=O |
| InChI | InChI=1S/C9H15N3O2/c1-8(2)5-10-4-3-9(8)6(13)11-7(14)12-9/h10H,3-5H2,1-2H3,(H2,11,12,13,14)/t9-/m1/s1 |
| InChIKey | PCOHJPXAIKNOPY-SECBINFHSA-N |
| XLogP | -0.42 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.24 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|