C11H20ClN3O2 — CID 135240843
3-ethyl-6,6-dimethyl-1,3,8-triazaspiro[4.5]decane-2,4-dione;hydrochloride (PubChem CID 135240843) has the molecular formula C11H20ClN3O2 and a molecular weight of 261.75 g/mol. Its IUPAC name is 3-ethyl-6,6-dimethyl-1,3,8-triazaspiro[4.5]decane-2,4-dione;hydrochloride.
| Compound Name | 3-ethyl-6,6-dimethyl-1,3,8-triazaspiro[4.5]decane-2,4-dione;hydrochloride |
|---|---|
| PubChem CID | 135240843 |
| Molecular Formula | C11H20ClN3O2 |
| Molecular Weight | 261.75 g/mol |
| Exact Mass | 261.12 |
| IUPAC Name | 3-ethyl-6,6-dimethyl-1,3,8-triazaspiro[4.5]decane-2,4-dione;hydrochloride |
| SMILES | CCN1C(=O)NC2(CCNCC2(C)C)C1=O.Cl |
| InChI | InChI=1S/C11H19N3O2.ClH/c1-4-14-8(15)11(13-9(14)16)5-6-12-7-10(11,2)3;/h12H,4-7H2,1-3H3,(H,13,16);1H |
| InChIKey | WUNPSFJIXZEEAV-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.75 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|