C13H16N2O — CID 121199787
1-ethylspiro[indole-3,3'-pyrrolidine]-2-one (PubChem CID 121199787) has the molecular formula C13H16N2O and a molecular weight of 216.28 g/mol. Its IUPAC name is 1-ethylspiro[indole-3,3'-pyrrolidine]-2-one.
| Compound Name | 1-ethylspiro[indole-3,3'-pyrrolidine]-2-one |
|---|---|
| PubChem CID | 121199787 |
| Molecular Formula | C13H16N2O |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.13 |
| IUPAC Name | 1-ethylspiro[indole-3,3'-pyrrolidine]-2-one |
| SMILES | CCN1C(=O)C2(CCNC2)c2ccccc21 |
| InChI | InChI=1S/C13H16N2O/c1-2-15-11-6-4-3-5-10(11)13(12(15)16)7-8-14-9-13/h3-6,14H,2,7-9H2,1H3 |
| InChIKey | UBPMJCNBTDBKDC-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |