C18H26N2O — CID 97400082
1'-[(2S)-butan-2-yl]-1-ethylspiro[indole-3,4'-piperidine]-2-one (PubChem CID 97400082) has the molecular formula C18H26N2O and a molecular weight of 286.42 g/mol. Its IUPAC name is 1'-[(2S)-butan-2-yl]-1-ethylspiro[indole-3,4'-piperidine]-2-one.
| Compound Name | 1'-[(2S)-butan-2-yl]-1-ethylspiro[indole-3,4'-piperidine]-2-one |
|---|---|
| PubChem CID | 97400082 |
| Molecular Formula | C18H26N2O |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.20 |
| IUPAC Name | 1'-[(2S)-butan-2-yl]-1-ethylspiro[indole-3,4'-piperidine]-2-one |
| SMILES | CC[C@H](C)N1CCC2(CC1)C(=O)N(CC)c1ccccc12 |
| InChI | InChI=1S/C18H26N2O/c1-4-14(3)19-12-10-18(11-13-19)15-8-6-7-9-16(15)20(5-2)17(18)21/h6-9,14H,4-5,10-13H2,1-3H3/t14-/m0/s1 |
| InChIKey | JYWURFPMTGAVCV-AWEZNQCLSA-N |
| XLogP | 3.19 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |