C15H17N3O3S — CID 97400115
2-(1'-methylsulfonyl-2-oxospiro[indole-3,4'-piperidine]-1-yl)acetonitrile (PubChem CID 97400115) has the molecular formula C15H17N3O3S and a molecular weight of 319.39 g/mol. Its IUPAC name is 2-(1'-methylsulfonyl-2-oxospiro[indole-3,4'-piperidine]-1-yl)acetonitrile.
| Compound Name | 2-(1'-methylsulfonyl-2-oxospiro[indole-3,4'-piperidine]-1-yl)acetonitrile |
|---|---|
| PubChem CID | 97400115 |
| Molecular Formula | C15H17N3O3S |
| Molecular Weight | 319.39 g/mol |
| Exact Mass | 319.10 |
| IUPAC Name | 2-(1'-methylsulfonyl-2-oxospiro[indole-3,4'-piperidine]-1-yl)acetonitrile |
| SMILES | CS(=O)(=O)N1CCC2(CC1)C(=O)N(CC#N)c1ccccc12 |
| InChI | InChI=1S/C15H17N3O3S/c1-22(20,21)17-9-6-15(7-10-17)12-4-2-3-5-13(12)18(11-8-16)14(15)19/h2-5H,6-7,9-11H2,1H3 |
| InChIKey | PRLJZTLNEBBWBH-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 81.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.39 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|