About 5-chloro-1'-propan-2-yl-1-propylspiro[indole-3,4'-piperidine]-2-one
5-chloro-1'-propan-2-yl-1-propylspiro[indole-3,4'-piperidine]-2-one (PubChem CID 170117340) has the molecular formula C18H25ClN2O
and a molecular weight of 320.86 g/mol. Its IUPAC name is 5-chloro-1'-propan-2-yl-1-propylspiro[indole-3,4'-piperidine]-2-one.
Molecular Properties
| Compound Name | 5-chloro-1'-propan-2-yl-1-propylspiro[indole-3,4'-piperidine]-2-one |
| PubChem CID | 170117340 |
| Molecular Formula | C18H25ClN2O |
| Molecular Weight | 320.86 g/mol |
| Exact Mass | 320.17 |
| IUPAC Name | 5-chloro-1'-propan-2-yl-1-propylspiro[indole-3,4'-piperidine]-2-one |
| SMILES | CCCN1C(=O)C2(CCN(C(C)C)CC2)c2cc(Cl)ccc21 |
| InChI | InChI=1S/C18H25ClN2O/c1-4-9-21-16-6-5-14(19)12-15(16)18(17(21)22)7-10-20(11-8-18)13(2)3/h5-6,12-13H,4,7-11H2,1-3H3 |
| InChIKey | PDPJFMNPAIXWES-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.86 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-chloro-1'-propan-2-yl-1-propylspiro[indole-3,4'-piperidine]-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-1'-propan-2-yl-1-propylspiro[indole-3,4'-piperidine]-2-one?
The IUPAC name of 5-chloro-1'-propan-2-yl-1-propylspiro[indole-3,4'-piperidine]-2-one (CID 170117340) is 5-chloro-1'-propan-2-yl-1-propylspiro[indole-3,4'-piperidine]-2-one.
What is the SMILES notation for 5-chloro-1'-propan-2-yl-1-propylspiro[indole-3,4'-piperidine]-2-one?
The canonical SMILES for 5-chloro-1'-propan-2-yl-1-propylspiro[indole-3,4'-piperidine]-2-one is CCCN1C(=O)C2(CCN(C(C)C)CC2)c2cc(Cl)ccc21.
What is the InChIKey of 5-chloro-1'-propan-2-yl-1-propylspiro[indole-3,4'-piperidine]-2-one?
The InChIKey is PDPJFMNPAIXWES-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H25ClN2O/c1-4-9-21-16-6-5-14(19)12-15(16)18(17(21)22)7-10-20(11-8-18)13(2)3/h5-6,12-13H,4,7-11H2,1-3H3.
What are the key properties of 5-chloro-1'-propan-2-yl-1-propylspiro[indole-3,4'-piperidine]-2-one?
5-chloro-1'-propan-2-yl-1-propylspiro[indole-3,4'-piperidine]-2-one has a molecular weight of 320.86 g/mol, XLogP of 3.84, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-1'-propan-2-yl-1-propylspiro[indole-3,4'-piperidine]-2-one is sourced from PubChem (CID 170117340), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).