C19H17Cl2NO3 — CID 2977337
3-[2-(2,4-dichlorophenyl)-2-oxoethyl]-3-hydroxy-1-propylindol-2-one (PubChem CID 2977337) has the molecular formula C19H17Cl2NO3 and a molecular weight of 378.26 g/mol. Its IUPAC name is 3-[2-(2,4-dichlorophenyl)-2-oxoethyl]-3-hydroxy-1-propylindol-2-one.
| Compound Name | 3-[2-(2,4-dichlorophenyl)-2-oxoethyl]-3-hydroxy-1-propylindol-2-one |
|---|---|
| PubChem CID | 2977337 |
| Molecular Formula | C19H17Cl2NO3 |
| Molecular Weight | 378.26 g/mol |
| Exact Mass | 377.06 |
| IUPAC Name | 3-[2-(2,4-dichlorophenyl)-2-oxoethyl]-3-hydroxy-1-propylindol-2-one |
| SMILES | CCCN1C(=O)C(O)(CC(=O)c2ccc(Cl)cc2Cl)c2ccccc21 |
| InChI | InChI=1S/C19H17Cl2NO3/c1-2-9-22-16-6-4-3-5-14(16)19(25,18(22)24)11-17(23)13-8-7-12(20)10-15(13)21/h3-8,10,25H,2,9,11H2,1H3 |
| InChIKey | PQLNXIGQZYVSBC-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.26 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |