C18H24ClNO3 — CID 18889511
5'-chloro-1'-heptylspiro[1,3-dioxane-2,3'-indole]-2'-one (PubChem CID 18889511) has the molecular formula C18H24ClNO3 and a molecular weight of 337.85 g/mol. Its IUPAC name is 5'-chloro-1'-heptylspiro[1,3-dioxane-2,3'-indole]-2'-one.
| Compound Name | 5'-chloro-1'-heptylspiro[1,3-dioxane-2,3'-indole]-2'-one |
|---|---|
| PubChem CID | 18889511 |
| Molecular Formula | C18H24ClNO3 |
| Molecular Weight | 337.85 g/mol |
| Exact Mass | 337.14 |
| IUPAC Name | 5'-chloro-1'-heptylspiro[1,3-dioxane-2,3'-indole]-2'-one |
| SMILES | CCCCCCCN1C(=O)C2(OCCCO2)c2cc(Cl)ccc21 |
| InChI | InChI=1S/C18H24ClNO3/c1-2-3-4-5-6-10-20-16-9-8-14(19)13-15(16)18(17(20)21)22-11-7-12-23-18/h8-9,13H,2-7,10-12H2,1H3 |
| InChIKey | LPQPPPFQXADMFR-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.85 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|