C18H25NO3 — CID 18889419
1'-hexyl-5'-methylspiro[1,3-dioxane-2,3'-indole]-2'-one (PubChem CID 18889419) has the molecular formula C18H25NO3 and a molecular weight of 303.40 g/mol. Its IUPAC name is 1'-hexyl-5'-methylspiro[1,3-dioxane-2,3'-indole]-2'-one.
| Compound Name | 1'-hexyl-5'-methylspiro[1,3-dioxane-2,3'-indole]-2'-one |
|---|---|
| PubChem CID | 18889419 |
| Molecular Formula | C18H25NO3 |
| Molecular Weight | 303.40 g/mol |
| Exact Mass | 303.18 |
| IUPAC Name | 1'-hexyl-5'-methylspiro[1,3-dioxane-2,3'-indole]-2'-one |
| SMILES | CCCCCCN1C(=O)C2(OCCCO2)c2cc(C)ccc21 |
| InChI | InChI=1S/C18H25NO3/c1-3-4-5-6-10-19-16-9-8-14(2)13-15(16)18(17(19)20)21-11-7-12-22-18/h8-9,13H,3-7,10-12H2,1-2H3 |
| InChIKey | FUKPRXCSAZSLLQ-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.40 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|