About 1-[(2-fluoro-4,5-dimethoxyphenyl)methyl]spiro[indole-3,3'-pyrrolidine]-2-one
1-[(2-fluoro-4,5-dimethoxyphenyl)methyl]spiro[indole-3,3'-pyrrolidine]-2-one (PubChem CID 155914766) has the molecular formula C20H21FN2O3
and a molecular weight of 356.40 g/mol. Its IUPAC name is 1-[(2-fluoro-4,5-dimethoxyphenyl)methyl]spiro[indole-3,3'-pyrrolidine]-2-one.
Molecular Properties
| Compound Name | 1-[(2-fluoro-4,5-dimethoxyphenyl)methyl]spiro[indole-3,3'-pyrrolidine]-2-one |
| PubChem CID | 155914766 |
| Molecular Formula | C20H21FN2O3 |
| Molecular Weight | 356.40 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | 1-[(2-fluoro-4,5-dimethoxyphenyl)methyl]spiro[indole-3,3'-pyrrolidine]-2-one |
| SMILES | COc1cc(F)c(CN2C(=O)C3(CCNC3)c3ccccc32)cc1OC |
| InChI | InChI=1S/C20H21FN2O3/c1-25-17-9-13(15(21)10-18(17)26-2)11-23-16-6-4-3-5-14(16)20(19(23)24)7-8-22-12-20/h3-6,9-10,22H,7-8,11-12H2,1-2H3 |
| InChIKey | VCTKNHRQXZBWOO-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.40 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[(2-fluoro-4,5-dimethoxyphenyl)methyl]spiro[indole-3,3'-pyrrolidine]-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2-fluoro-4,5-dimethoxyphenyl)methyl]spiro[indole-3,3'-pyrrolidine]-2-one?
The IUPAC name of 1-[(2-fluoro-4,5-dimethoxyphenyl)methyl]spiro[indole-3,3'-pyrrolidine]-2-one (CID 155914766) is 1-[(2-fluoro-4,5-dimethoxyphenyl)methyl]spiro[indole-3,3'-pyrrolidine]-2-one.
What is the SMILES notation for 1-[(2-fluoro-4,5-dimethoxyphenyl)methyl]spiro[indole-3,3'-pyrrolidine]-2-one?
The canonical SMILES for 1-[(2-fluoro-4,5-dimethoxyphenyl)methyl]spiro[indole-3,3'-pyrrolidine]-2-one is COc1cc(F)c(CN2C(=O)C3(CCNC3)c3ccccc32)cc1OC.
What is the InChIKey of 1-[(2-fluoro-4,5-dimethoxyphenyl)methyl]spiro[indole-3,3'-pyrrolidine]-2-one?
The InChIKey is VCTKNHRQXZBWOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H21FN2O3/c1-25-17-9-13(15(21)10-18(17)26-2)11-23-16-6-4-3-5-14(16)20(19(23)24)7-8-22-12-20/h3-6,9-10,22H,7-8,11-12H2,1-2H3.
What are the key properties of 1-[(2-fluoro-4,5-dimethoxyphenyl)methyl]spiro[indole-3,3'-pyrrolidine]-2-one?
1-[(2-fluoro-4,5-dimethoxyphenyl)methyl]spiro[indole-3,3'-pyrrolidine]-2-one has a molecular weight of 356.40 g/mol, XLogP of 2.62, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2-fluoro-4,5-dimethoxyphenyl)methyl]spiro[indole-3,3'-pyrrolidine]-2-one is sourced from PubChem (CID 155914766), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).