C18H21NO3 — CID 139816614
2-[3-(3,4-dimethoxyphenyl)pyrrolidin-3-yl]phenol (PubChem CID 139816614) has the molecular formula C18H21NO3 and a molecular weight of 299.37 g/mol. Its IUPAC name is 2-[3-(3,4-dimethoxyphenyl)pyrrolidin-3-yl]phenol.
| Compound Name | 2-[3-(3,4-dimethoxyphenyl)pyrrolidin-3-yl]phenol |
|---|---|
| PubChem CID | 139816614 |
| Molecular Formula | C18H21NO3 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.15 |
| IUPAC Name | 2-[3-(3,4-dimethoxyphenyl)pyrrolidin-3-yl]phenol |
| SMILES | COc1ccc(C2(c3ccccc3O)CCNC2)cc1OC |
| InChI | InChI=1S/C18H21NO3/c1-21-16-8-7-13(11-17(16)22-2)18(9-10-19-12-18)14-5-3-4-6-15(14)20/h3-8,11,19-20H,9-10,12H2,1-2H3 |
| InChIKey | XSNLAZUSENUEDR-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |