About 1-[(3,4-dichlorophenyl)methyl]spiro[indole-3,3'-pyrrolidine]-2-one;hydrochloride
1-[(3,4-dichlorophenyl)methyl]spiro[indole-3,3'-pyrrolidine]-2-one;hydrochloride (PubChem CID 155972674) has the molecular formula C18H17Cl3N2O
and a molecular weight of 383.71 g/mol. Its IUPAC name is 1-[(3,4-dichlorophenyl)methyl]spiro[indole-3,3'-pyrrolidine]-2-one;hydrochloride.
Molecular Properties
| Compound Name | 1-[(3,4-dichlorophenyl)methyl]spiro[indole-3,3'-pyrrolidine]-2-one;hydrochloride |
| PubChem CID | 155972674 |
| Molecular Formula | C18H17Cl3N2O |
| Molecular Weight | 383.71 g/mol |
| Exact Mass | 382.04 |
| IUPAC Name | 1-[(3,4-dichlorophenyl)methyl]spiro[indole-3,3'-pyrrolidine]-2-one;hydrochloride |
| SMILES | Cl.O=C1N(Cc2ccc(Cl)c(Cl)c2)c2ccccc2C12CCNC2 |
| InChI | InChI=1S/C18H16Cl2N2O.ClH/c19-14-6-5-12(9-15(14)20)10-22-16-4-2-1-3-13(16)18(17(22)23)7-8-21-11-18;/h1-6,9,21H,7-8,10-11H2;1H |
| InChIKey | GCDGEMHRFZYYDI-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 383.71 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[(3,4-dichlorophenyl)methyl]spiro[indole-3,3'-pyrrolidine]-2-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3,4-dichlorophenyl)methyl]spiro[indole-3,3'-pyrrolidine]-2-one;hydrochloride?
The IUPAC name of 1-[(3,4-dichlorophenyl)methyl]spiro[indole-3,3'-pyrrolidine]-2-one;hydrochloride (CID 155972674) is 1-[(3,4-dichlorophenyl)methyl]spiro[indole-3,3'-pyrrolidine]-2-one;hydrochloride.
What is the SMILES notation for 1-[(3,4-dichlorophenyl)methyl]spiro[indole-3,3'-pyrrolidine]-2-one;hydrochloride?
The canonical SMILES for 1-[(3,4-dichlorophenyl)methyl]spiro[indole-3,3'-pyrrolidine]-2-one;hydrochloride is Cl.O=C1N(Cc2ccc(Cl)c(Cl)c2)c2ccccc2C12CCNC2.
What is the InChIKey of 1-[(3,4-dichlorophenyl)methyl]spiro[indole-3,3'-pyrrolidine]-2-one;hydrochloride?
The InChIKey is GCDGEMHRFZYYDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16Cl2N2O.ClH/c19-14-6-5-12(9-15(14)20)10-22-16-4-2-1-3-13(16)18(17(22)23)7-8-21-11-18;/h1-6,9,21H,7-8,10-11H2;1H.
What are the key properties of 1-[(3,4-dichlorophenyl)methyl]spiro[indole-3,3'-pyrrolidine]-2-one;hydrochloride?
1-[(3,4-dichlorophenyl)methyl]spiro[indole-3,3'-pyrrolidine]-2-one;hydrochloride has a molecular weight of 383.71 g/mol, XLogP of 4.19, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3,4-dichlorophenyl)methyl]spiro[indole-3,3'-pyrrolidine]-2-one;hydrochloride is sourced from PubChem (CID 155972674), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).