C9H14N2O3 — CID 78924545
3-ethyl-8-oxa-1,3-diazaspiro[4.5]decane-2,4-dione (PubChem CID 78924545) has the molecular formula C9H14N2O3 and a molecular weight of 198.22 g/mol. Its IUPAC name is 3-ethyl-8-oxa-1,3-diazaspiro[4.5]decane-2,4-dione.
| Compound Name | 3-ethyl-8-oxa-1,3-diazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 78924545 |
| Molecular Formula | C9H14N2O3 |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.10 |
| IUPAC Name | 3-ethyl-8-oxa-1,3-diazaspiro[4.5]decane-2,4-dione |
| SMILES | CCN1C(=O)NC2(CCOCC2)C1=O |
| InChI | InChI=1S/C9H14N2O3/c1-2-11-7(12)9(10-8(11)13)3-5-14-6-4-9/h2-6H2,1H3,(H,10,13) |
| InChIKey | PFPVSAHUFAKQNY-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|