C11H15N5O3S — CID 106528256
3-[[5-(methylamino)-1,3,4-thiadiazol-2-yl]methyl]-8-oxa-1,3-diazaspiro[4.5]decane-2,4-dione (PubChem CID 106528256) has the molecular formula C11H15N5O3S and a molecular weight of 297.34 g/mol. Its IUPAC name is 3-[[5-(methylamino)-1,3,4-thiadiazol-2-yl]methyl]-8-oxa-1,3-diazaspiro[4.5]decane-2,4-dione.
| Compound Name | 3-[[5-(methylamino)-1,3,4-thiadiazol-2-yl]methyl]-8-oxa-1,3-diazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 106528256 |
| Molecular Formula | C11H15N5O3S |
| Molecular Weight | 297.34 g/mol |
| Exact Mass | 297.09 |
| IUPAC Name | 3-[[5-(methylamino)-1,3,4-thiadiazol-2-yl]methyl]-8-oxa-1,3-diazaspiro[4.5]decane-2,4-dione |
| SMILES | CNc1nnc(CN2C(=O)NC3(CCOCC3)C2=O)s1 |
| InChI | InChI=1S/C11H15N5O3S/c1-12-9-15-14-7(20-9)6-16-8(17)11(13-10(16)18)2-4-19-5-3-11/h2-6H2,1H3,(H,12,15)(H,13,18) |
| InChIKey | JDECDCOQINUEQD-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 96.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.34 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|