C10H14N6O2S — CID 80613383
3-[(5-hydrazinyl-1,3,4-thiadiazol-2-yl)methyl]-1,3-diazaspiro[4.4]nonane-2,4-dione (PubChem CID 80613383) has the molecular formula C10H14N6O2S and a molecular weight of 282.33 g/mol. Its IUPAC name is 3-[(5-hydrazinyl-1,3,4-thiadiazol-2-yl)methyl]-1,3-diazaspiro[4.4]nonane-2,4-dione.
| Compound Name | 3-[(5-hydrazinyl-1,3,4-thiadiazol-2-yl)methyl]-1,3-diazaspiro[4.4]nonane-2,4-dione |
|---|---|
| PubChem CID | 80613383 |
| Molecular Formula | C10H14N6O2S |
| Molecular Weight | 282.33 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | 3-[(5-hydrazinyl-1,3,4-thiadiazol-2-yl)methyl]-1,3-diazaspiro[4.4]nonane-2,4-dione |
| SMILES | NNc1nnc(CN2C(=O)NC3(CCCC3)C2=O)s1 |
| InChI | InChI=1S/C10H14N6O2S/c11-13-8-15-14-6(19-8)5-16-7(17)10(12-9(16)18)3-1-2-4-10/h1-5,11H2,(H,12,18)(H,13,15) |
| InChIKey | LDABNBYQDGPXAP-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 113.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.33 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|