C9H14N6O2S — CID 80613286
3-ethyl-4-[(5-hydrazinyl-1,3,4-thiadiazol-2-yl)methyl]piperazine-2,6-dione (PubChem CID 80613286) has the molecular formula C9H14N6O2S and a molecular weight of 270.32 g/mol. Its IUPAC name is 3-ethyl-4-[(5-hydrazinyl-1,3,4-thiadiazol-2-yl)methyl]piperazine-2,6-dione.
| Compound Name | 3-ethyl-4-[(5-hydrazinyl-1,3,4-thiadiazol-2-yl)methyl]piperazine-2,6-dione |
|---|---|
| PubChem CID | 80613286 |
| Molecular Formula | C9H14N6O2S |
| Molecular Weight | 270.32 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | 3-ethyl-4-[(5-hydrazinyl-1,3,4-thiadiazol-2-yl)methyl]piperazine-2,6-dione |
| SMILES | CCC1C(=O)NC(=O)CN1Cc1nnc(NN)s1 |
| InChI | InChI=1S/C9H14N6O2S/c1-2-5-8(17)11-6(16)3-15(5)4-7-13-14-9(12-10)18-7/h5H,2-4,10H2,1H3,(H,12,14)(H,11,16,17) |
| InChIKey | NDTDFEADULSJOV-UHFFFAOYSA-N |
| XLogP | -0.94 |
| TPSA | 113.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.32 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|