C8H14N4O3 — CID 66069169
2-(2-ethyl-3,5-dioxopiperazin-1-yl)acetohydrazide (PubChem CID 66069169) has the molecular formula C8H14N4O3 and a molecular weight of 214.22 g/mol. Its IUPAC name is 2-(2-ethyl-3,5-dioxopiperazin-1-yl)acetohydrazide.
| Compound Name | 2-(2-ethyl-3,5-dioxopiperazin-1-yl)acetohydrazide |
|---|---|
| PubChem CID | 66069169 |
| Molecular Formula | C8H14N4O3 |
| Molecular Weight | 214.22 g/mol |
| Exact Mass | 214.11 |
| IUPAC Name | 2-(2-ethyl-3,5-dioxopiperazin-1-yl)acetohydrazide |
| SMILES | CCC1C(=O)NC(=O)CN1CC(=O)NN |
| InChI | InChI=1S/C8H14N4O3/c1-2-5-8(15)10-6(13)3-12(5)4-7(14)11-9/h5H,2-4,9H2,1H3,(H,11,14)(H,10,13,15) |
| InChIKey | LFFPLWJQAHVRQK-UHFFFAOYSA-N |
| XLogP | -2.29 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.22 |
| LogP ≤ 5 | -2.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|