C12H21N5O2 — CID 104887109
N-amino-N'-cyclopentyl-2-ethyl-3,5-dioxopiperazine-1-carboximidamide (PubChem CID 104887109) has the molecular formula C12H21N5O2 and a molecular weight of 267.33 g/mol. Its IUPAC name is N-amino-N'-cyclopentyl-2-ethyl-3,5-dioxopiperazine-1-carboximidamide.
| Compound Name | N-amino-N'-cyclopentyl-2-ethyl-3,5-dioxopiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 104887109 |
| Molecular Formula | C12H21N5O2 |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.17 |
| IUPAC Name | N-amino-N'-cyclopentyl-2-ethyl-3,5-dioxopiperazine-1-carboximidamide |
| SMILES | CCC1C(=O)NC(=O)CN1/C(=N/C1CCCC1)NN |
| InChI | InChI=1S/C12H21N5O2/c1-2-9-11(19)15-10(18)7-17(9)12(16-13)14-8-5-3-4-6-8/h8-9H,2-7,13H2,1H3,(H,14,16)(H,15,18,19) |
| InChIKey | FZQYIMYUGYHRCL-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 99.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|