C9H15N5O2 — CID 66069154
4-(3-azidopropyl)-3-ethylpiperazine-2,6-dione (PubChem CID 66069154) has the molecular formula C9H15N5O2 and a molecular weight of 225.25 g/mol. Its IUPAC name is 4-(3-azidopropyl)-3-ethylpiperazine-2,6-dione.
| Compound Name | 4-(3-azidopropyl)-3-ethylpiperazine-2,6-dione |
|---|---|
| PubChem CID | 66069154 |
| Molecular Formula | C9H15N5O2 |
| Molecular Weight | 225.25 g/mol |
| Exact Mass | 225.12 |
| IUPAC Name | 4-(3-azidopropyl)-3-ethylpiperazine-2,6-dione |
| SMILES | CCC1C(=O)NC(=O)CN1CCCN=[N+]=[N-] |
| InChI | InChI=1S/C9H15N5O2/c1-2-7-9(16)12-8(15)6-14(7)5-3-4-11-13-10/h7H,2-6H2,1H3,(H,12,15,16) |
| InChIKey | IBLLYBAZNCXJRB-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 98.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.25 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|