C7H11N5O2 — CID 66084230
4-(3-azidopropyl)piperazine-2,6-dione (PubChem CID 66084230) has the molecular formula C7H11N5O2 and a molecular weight of 197.20 g/mol. Its IUPAC name is 4-(3-azidopropyl)piperazine-2,6-dione.
| Compound Name | 4-(3-azidopropyl)piperazine-2,6-dione |
|---|---|
| PubChem CID | 66084230 |
| Molecular Formula | C7H11N5O2 |
| Molecular Weight | 197.20 g/mol |
| Exact Mass | 197.09 |
| IUPAC Name | 4-(3-azidopropyl)piperazine-2,6-dione |
| SMILES | [N-]=[N+]=NCCCN1CC(=O)NC(=O)C1 |
| InChI | InChI=1S/C7H11N5O2/c8-11-9-2-1-3-12-4-6(13)10-7(14)5-12/h1-5H2,(H,10,13,14) |
| InChIKey | QIIBMQGDJXGNIE-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 98.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.20 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|