C17H19N3O2S — CID 2701734
3-(1,3-benzothiazol-2-ylmethyl)-1,3-diazaspiro[4.6]undecane-2,4-dione (PubChem CID 2701734) has the molecular formula C17H19N3O2S and a molecular weight of 329.42 g/mol. Its IUPAC name is 3-(1,3-benzothiazol-2-ylmethyl)-1,3-diazaspiro[4.6]undecane-2,4-dione.
| Compound Name | 3-(1,3-benzothiazol-2-ylmethyl)-1,3-diazaspiro[4.6]undecane-2,4-dione |
|---|---|
| PubChem CID | 2701734 |
| Molecular Formula | C17H19N3O2S |
| Molecular Weight | 329.42 g/mol |
| Exact Mass | 329.12 |
| IUPAC Name | 3-(1,3-benzothiazol-2-ylmethyl)-1,3-diazaspiro[4.6]undecane-2,4-dione |
| SMILES | O=C1NC2(CCCCCC2)C(=O)N1Cc1nc2ccccc2s1 |
| InChI | InChI=1S/C17H19N3O2S/c21-15-17(9-5-1-2-6-10-17)19-16(22)20(15)11-14-18-12-7-3-4-8-13(12)23-14/h3-4,7-8H,1-2,5-6,9-11H2,(H,19,22) |
| InChIKey | LIKSFGOEMQRQTR-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.42 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|