C20H19N3O3S — CID 7802364
(5R)-3-(1,3-benzothiazol-2-ylmethyl)-5-ethyl-5-(4-methoxyphenyl)imidazolidine-2,4-dione (PubChem CID 7802364) has the molecular formula C20H19N3O3S and a molecular weight of 381.46 g/mol. Its IUPAC name is (5R)-3-(1,3-benzothiazol-2-ylmethyl)-5-ethyl-5-(4-methoxyphenyl)imidazolidine-2,4-dione.
| Compound Name | (5R)-3-(1,3-benzothiazol-2-ylmethyl)-5-ethyl-5-(4-methoxyphenyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 7802364 |
| Molecular Formula | C20H19N3O3S |
| Molecular Weight | 381.46 g/mol |
| Exact Mass | 381.11 |
| IUPAC Name | (5R)-3-(1,3-benzothiazol-2-ylmethyl)-5-ethyl-5-(4-methoxyphenyl)imidazolidine-2,4-dione |
| SMILES | CC[C@]1(c2ccc(OC)cc2)NC(=O)N(Cc2nc3ccccc3s2)C1=O |
| InChI | InChI=1S/C20H19N3O3S/c1-3-20(13-8-10-14(26-2)11-9-13)18(24)23(19(25)22-20)12-17-21-15-6-4-5-7-16(15)27-17/h4-11H,3,12H2,1-2H3,(H,22,25)/t20-/m1/s1 |
| InChIKey | ATSOJHQQQGTYPA-HXUWFJFHSA-N |
| XLogP | 3.66 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.46 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|