C20H19N3O2S — CID 8586905
(5S)-3-(1,3-benzothiazol-2-ylmethyl)-5-ethyl-5-(4-methylphenyl)imidazolidine-2,4-dione (PubChem CID 8586905) has the molecular formula C20H19N3O2S and a molecular weight of 365.46 g/mol. Its IUPAC name is (5S)-3-(1,3-benzothiazol-2-ylmethyl)-5-ethyl-5-(4-methylphenyl)imidazolidine-2,4-dione.
| Compound Name | (5S)-3-(1,3-benzothiazol-2-ylmethyl)-5-ethyl-5-(4-methylphenyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 8586905 |
| Molecular Formula | C20H19N3O2S |
| Molecular Weight | 365.46 g/mol |
| Exact Mass | 365.12 |
| IUPAC Name | (5S)-3-(1,3-benzothiazol-2-ylmethyl)-5-ethyl-5-(4-methylphenyl)imidazolidine-2,4-dione |
| SMILES | CC[C@@]1(c2ccc(C)cc2)NC(=O)N(Cc2nc3ccccc3s2)C1=O |
| InChI | InChI=1S/C20H19N3O2S/c1-3-20(14-10-8-13(2)9-11-14)18(24)23(19(25)22-20)12-17-21-15-6-4-5-7-16(15)26-17/h4-11H,3,12H2,1-2H3,(H,22,25)/t20-/m0/s1 |
| InChIKey | RJTAMXQVNICVBE-FQEVSTJZSA-N |
| XLogP | 3.96 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.46 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|