C21H19N3O4S — CID 7709452
1,3-benzothiazol-2-ylmethyl 2-[(4S)-4-methyl-4-(4-methylphenyl)-2,5-dioxoimidazolidin-1-yl]acetate (PubChem CID 7709452) has the molecular formula C21H19N3O4S and a molecular weight of 409.47 g/mol. Its IUPAC name is 1,3-benzothiazol-2-ylmethyl 2-[(4S)-4-methyl-4-(4-methylphenyl)-2,5-dioxoimidazolidin-1-yl]acetate.
| Compound Name | 1,3-benzothiazol-2-ylmethyl 2-[(4S)-4-methyl-4-(4-methylphenyl)-2,5-dioxoimidazolidin-1-yl]acetate |
|---|---|
| PubChem CID | 7709452 |
| Molecular Formula | C21H19N3O4S |
| Molecular Weight | 409.47 g/mol |
| Exact Mass | 409.11 |
| IUPAC Name | 1,3-benzothiazol-2-ylmethyl 2-[(4S)-4-methyl-4-(4-methylphenyl)-2,5-dioxoimidazolidin-1-yl]acetate |
| SMILES | Cc1ccc([C@]2(C)NC(=O)N(CC(=O)OCc3nc4ccccc4s3)C2=O)cc1 |
| InChI | InChI=1S/C21H19N3O4S/c1-13-7-9-14(10-8-13)21(2)19(26)24(20(27)23-21)11-18(25)28-12-17-22-15-5-3-4-6-16(15)29-17/h3-10H,11-12H2,1-2H3,(H,23,27)/t21-/m0/s1 |
| InChIKey | WYYLCSGGOZADTP-NRFANRHFSA-N |
| XLogP | 3.12 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.47 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|