1,3-benzothiazol-2-ylmethyl 2-(4-methylphenyl)acetate

C17H15NO2S — CID 60604347

IUPAC1,3-benzothiazol-2-ylmethyl 2-(4-methylphenyl)acetate
SMILESCc1ccc(CC(=O)OCc2nc3ccccc3s2)cc1
InChIInChI=1S/C17H15NO2S/c1-12-6-8-13(9-7-12)10-17(19)20-11-16-18-14-4-2-3-5-15(14)21-16/h2-9H,10-11H2,1H3
InChIKeyQAXQWTRTMYGZKI-UHFFFAOYSA-N
MW297.38 g/mol
LogP3.89
Rot. Bonds4

About 1,3-benzothiazol-2-ylmethyl 2-(4-methylphenyl)acetate

1,3-benzothiazol-2-ylmethyl 2-(4-methylphenyl)acetate (PubChem CID 60604347) has the molecular formula C17H15NO2S and a molecular weight of 297.38 g/mol. Its IUPAC name is 1,3-benzothiazol-2-ylmethyl 2-(4-methylphenyl)acetate.

Molecular Properties

Compound Name1,3-benzothiazol-2-ylmethyl 2-(4-methylphenyl)acetate
PubChem CID60604347
Molecular FormulaC17H15NO2S
Molecular Weight297.38 g/mol
Exact Mass297.08
IUPAC Name1,3-benzothiazol-2-ylmethyl 2-(4-methylphenyl)acetate
SMILESCc1ccc(CC(=O)OCc2nc3ccccc3s2)cc1
InChIInChI=1S/C17H15NO2S/c1-12-6-8-13(9-7-12)10-17(19)20-11-16-18-14-4-2-3-5-15(14)21-16/h2-9H,10-11H2,1H3
InChIKeyQAXQWTRTMYGZKI-UHFFFAOYSA-N
XLogP3.89
TPSA39.19 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms21
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500297.38
LogP ≤ 53.89
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze 1,3-benzothiazol-2-ylmethyl 2-(4-methylphenyl)acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1,3-benzothiazol-2-ylmethyl 2-(4-methylphenyl)acetate?
The IUPAC name of 1,3-benzothiazol-2-ylmethyl 2-(4-methylphenyl)acetate (CID 60604347) is 1,3-benzothiazol-2-ylmethyl 2-(4-methylphenyl)acetate.
What is the SMILES notation for 1,3-benzothiazol-2-ylmethyl 2-(4-methylphenyl)acetate?
The canonical SMILES for 1,3-benzothiazol-2-ylmethyl 2-(4-methylphenyl)acetate is Cc1ccc(CC(=O)OCc2nc3ccccc3s2)cc1.
What is the InChIKey of 1,3-benzothiazol-2-ylmethyl 2-(4-methylphenyl)acetate?
The InChIKey is QAXQWTRTMYGZKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15NO2S/c1-12-6-8-13(9-7-12)10-17(19)20-11-16-18-14-4-2-3-5-15(14)21-16/h2-9H,10-11H2,1H3.
What are the key properties of 1,3-benzothiazol-2-ylmethyl 2-(4-methylphenyl)acetate?
1,3-benzothiazol-2-ylmethyl 2-(4-methylphenyl)acetate has a molecular weight of 297.38 g/mol, XLogP of 3.89, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-benzothiazol-2-ylmethyl 2-(4-methylphenyl)acetate is sourced from PubChem (CID 60604347), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).