C16H13NO3S — CID 2611498
1,3-benzothiazol-2-ylmethyl 2-hydroxy-4-methylbenzoate (PubChem CID 2611498) has the molecular formula C16H13NO3S and a molecular weight of 299.35 g/mol. Its IUPAC name is 1,3-benzothiazol-2-ylmethyl 2-hydroxy-4-methylbenzoate.
| Compound Name | 1,3-benzothiazol-2-ylmethyl 2-hydroxy-4-methylbenzoate |
|---|---|
| PubChem CID | 2611498 |
| Molecular Formula | C16H13NO3S |
| Molecular Weight | 299.35 g/mol |
| Exact Mass | 299.06 |
| IUPAC Name | 1,3-benzothiazol-2-ylmethyl 2-hydroxy-4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)OCc2nc3ccccc3s2)c(O)c1 |
| InChI | InChI=1S/C16H13NO3S/c1-10-6-7-11(13(18)8-10)16(19)20-9-15-17-12-4-2-3-5-14(12)21-15/h2-8,18H,9H2,1H3 |
| InChIKey | DVLQIRMXJWBOEH-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.35 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |