2-(1,3-benzothiazol-2-ylmethoxy)-5-methylbenzoic acid

C16H13NO3S — CID 60652782

IUPAC2-(1,3-benzothiazol-2-ylmethoxy)-5-methylbenzoic acid
SMILESCc1ccc(OCc2nc3ccccc3s2)c(C(=O)O)c1
InChIInChI=1S/C16H13NO3S/c1-10-6-7-13(11(8-10)16(18)19)20-9-15-17-12-4-2-3-5-14(12)21-15/h2-8H,9H2,1H3,(H,18,19)
InChIKeyYOMHIGKEZMIVHW-UHFFFAOYSA-N
MW299.35 g/mol
LogP3.88
Rot. Bonds4

About 2-(1,3-benzothiazol-2-ylmethoxy)-5-methylbenzoic acid

2-(1,3-benzothiazol-2-ylmethoxy)-5-methylbenzoic acid (PubChem CID 60652782) has the molecular formula C16H13NO3S and a molecular weight of 299.35 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-ylmethoxy)-5-methylbenzoic acid.

Molecular Properties

Compound Name2-(1,3-benzothiazol-2-ylmethoxy)-5-methylbenzoic acid
PubChem CID60652782
Molecular FormulaC16H13NO3S
Molecular Weight299.35 g/mol
Exact Mass299.06
IUPAC Name2-(1,3-benzothiazol-2-ylmethoxy)-5-methylbenzoic acid
SMILESCc1ccc(OCc2nc3ccccc3s2)c(C(=O)O)c1
InChIInChI=1S/C16H13NO3S/c1-10-6-7-13(11(8-10)16(18)19)20-9-15-17-12-4-2-3-5-14(12)21-15/h2-8H,9H2,1H3,(H,18,19)
InChIKeyYOMHIGKEZMIVHW-UHFFFAOYSA-N
XLogP3.88
TPSA59.42 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500299.35
LogP ≤ 53.88
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 2-(1,3-benzothiazol-2-ylmethoxy)-5-methylbenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(1,3-benzothiazol-2-ylmethoxy)-5-methylbenzoic acid?
The IUPAC name of 2-(1,3-benzothiazol-2-ylmethoxy)-5-methylbenzoic acid (CID 60652782) is 2-(1,3-benzothiazol-2-ylmethoxy)-5-methylbenzoic acid.
What is the SMILES notation for 2-(1,3-benzothiazol-2-ylmethoxy)-5-methylbenzoic acid?
The canonical SMILES for 2-(1,3-benzothiazol-2-ylmethoxy)-5-methylbenzoic acid is Cc1ccc(OCc2nc3ccccc3s2)c(C(=O)O)c1.
What is the InChIKey of 2-(1,3-benzothiazol-2-ylmethoxy)-5-methylbenzoic acid?
The InChIKey is YOMHIGKEZMIVHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13NO3S/c1-10-6-7-13(11(8-10)16(18)19)20-9-15-17-12-4-2-3-5-14(12)21-15/h2-8H,9H2,1H3,(H,18,19).
What are the key properties of 2-(1,3-benzothiazol-2-ylmethoxy)-5-methylbenzoic acid?
2-(1,3-benzothiazol-2-ylmethoxy)-5-methylbenzoic acid has a molecular weight of 299.35 g/mol, XLogP of 3.88, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,3-benzothiazol-2-ylmethoxy)-5-methylbenzoic acid is sourced from PubChem (CID 60652782), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).