C17H17NO2S — CID 104631332
(1R)-1-[4-(1,3-benzothiazol-2-ylmethoxy)-3-methylphenyl]ethanol (PubChem CID 104631332) has the molecular formula C17H17NO2S and a molecular weight of 299.39 g/mol. Its IUPAC name is (1R)-1-[4-(1,3-benzothiazol-2-ylmethoxy)-3-methylphenyl]ethanol.
| Compound Name | (1R)-1-[4-(1,3-benzothiazol-2-ylmethoxy)-3-methylphenyl]ethanol |
|---|---|
| PubChem CID | 104631332 |
| Molecular Formula | C17H17NO2S |
| Molecular Weight | 299.39 g/mol |
| Exact Mass | 299.10 |
| IUPAC Name | (1R)-1-[4-(1,3-benzothiazol-2-ylmethoxy)-3-methylphenyl]ethanol |
| SMILES | Cc1cc([C@@H](C)O)ccc1OCc1nc2ccccc2s1 |
| InChI | InChI=1S/C17H17NO2S/c1-11-9-13(12(2)19)7-8-15(11)20-10-17-18-14-5-3-4-6-16(14)21-17/h3-9,12,19H,10H2,1-2H3/t12-/m1/s1 |
| InChIKey | LEELNLRNUASEIW-GFCCVEGCSA-N |
| XLogP | 4.24 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.39 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |