C15H12ClNO2S — CID 115761235
[4-(1,3-benzothiazol-2-ylmethoxy)-3-chlorophenyl]methanol (PubChem CID 115761235) has the molecular formula C15H12ClNO2S and a molecular weight of 305.79 g/mol. Its IUPAC name is [4-(1,3-benzothiazol-2-ylmethoxy)-3-chlorophenyl]methanol.
| Compound Name | [4-(1,3-benzothiazol-2-ylmethoxy)-3-chlorophenyl]methanol |
|---|---|
| PubChem CID | 115761235 |
| Molecular Formula | C15H12ClNO2S |
| Molecular Weight | 305.79 g/mol |
| Exact Mass | 305.03 |
| IUPAC Name | [4-(1,3-benzothiazol-2-ylmethoxy)-3-chlorophenyl]methanol |
| SMILES | OCc1ccc(OCc2nc3ccccc3s2)c(Cl)c1 |
| InChI | InChI=1S/C15H12ClNO2S/c16-11-7-10(8-18)5-6-13(11)19-9-15-17-12-3-1-2-4-14(12)20-15/h1-7,18H,8-9H2 |
| InChIKey | RKJRUUNQZIRRFL-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.79 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |