C15H12N2O3S — CID 104631513
3-amino-4-(1,3-benzothiazol-2-ylmethoxy)benzoic acid (PubChem CID 104631513) has the molecular formula C15H12N2O3S and a molecular weight of 300.34 g/mol. Its IUPAC name is 3-amino-4-(1,3-benzothiazol-2-ylmethoxy)benzoic acid.
| Compound Name | 3-amino-4-(1,3-benzothiazol-2-ylmethoxy)benzoic acid |
|---|---|
| PubChem CID | 104631513 |
| Molecular Formula | C15H12N2O3S |
| Molecular Weight | 300.34 g/mol |
| Exact Mass | 300.06 |
| IUPAC Name | 3-amino-4-(1,3-benzothiazol-2-ylmethoxy)benzoic acid |
| SMILES | Nc1cc(C(=O)O)ccc1OCc1nc2ccccc2s1 |
| InChI | InChI=1S/C15H12N2O3S/c16-10-7-9(15(18)19)5-6-12(10)20-8-14-17-11-3-1-2-4-13(11)21-14/h1-7H,8,16H2,(H,18,19) |
| InChIKey | QYOSXGVGSLFRFS-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 85.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.34 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|