C14H10Cl2N2OS — CID 104630885
4-(1,3-benzothiazol-2-ylmethoxy)-3,5-dichloroaniline (PubChem CID 104630885) has the molecular formula C14H10Cl2N2OS and a molecular weight of 325.22 g/mol. Its IUPAC name is 4-(1,3-benzothiazol-2-ylmethoxy)-3,5-dichloroaniline.
| Compound Name | 4-(1,3-benzothiazol-2-ylmethoxy)-3,5-dichloroaniline |
|---|---|
| PubChem CID | 104630885 |
| Molecular Formula | C14H10Cl2N2OS |
| Molecular Weight | 325.22 g/mol |
| Exact Mass | 323.99 |
| IUPAC Name | 4-(1,3-benzothiazol-2-ylmethoxy)-3,5-dichloroaniline |
| SMILES | Nc1cc(Cl)c(OCc2nc3ccccc3s2)c(Cl)c1 |
| InChI | InChI=1S/C14H10Cl2N2OS/c15-9-5-8(17)6-10(16)14(9)19-7-13-18-11-3-1-2-4-12(11)20-13/h1-6H,7,17H2 |
| InChIKey | PWGXFGYRPYEAIZ-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.22 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|